Products 2918880-24-5
CAS 2918880-24-5 is the registry number for 2-(Benzyloxy)-1-bromo-3-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-phenylmethoxy-3-(trifluoromethyl)benzene (CAS 2918880-24-5) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 1-bromo-2-phenylmethoxy-3-(trifluoromethyl)benzene. InChIKey: GRGJADQGFRPZHS-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 1-bromo-2-phenylmethoxy-3-(trifluoromethyl)benzene |
| InChIKey | GRGJADQGFRPZHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=C2Br)C(F)(F)F |
Computed by PubChem (NCBI)