Products 2764731-81-7
CAS 2764731-81-7 is the registry number for 4'-Bromo-2-methoxy-5-(trifluoromethyl)-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(4-bromophenyl)-1-methoxy-4-(trifluoromethyl)benzene (CAS 2764731-81-7) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 2-(4-bromophenyl)-1-methoxy-4-(trifluoromethyl)benzene. InChIKey: UCQKRUFIVSPTJP-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1-methoxy-4-(trifluoromethyl)benzene |
| InChIKey | UCQKRUFIVSPTJP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)