Products 10445-02-0
CAS 10445-02-0 is the registry number for 5-(3-(Trifluoromethyl)phenyl)-1,3,4-thiadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine (CAS 10445-02-0) is a chemical compound with the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. IUPAC name: 5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine. InChIKey: OWEVQLAGEVSZQL-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | OWEVQLAGEVSZQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NN=C(S2)N |
Computed by PubChem (NCBI)