Products 2529569-27-3
CAS 2529569-27-3 is the registry number for 2-(Methylthio)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfanyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine (CAS 2529569-27-3) is a chemical compound with the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. IUPAC name: 2-methylsulfanyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine. InChIKey: ULHJCJQFPZDTIC-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 2-methylsulfanyl-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine |
| InChIKey | ULHJCJQFPZDTIC-UHFFFAOYSA-N |
| SMILES | CSC1=NC=C2C=CC(=NC2=N1)C(F)(F)F |
Computed by PubChem (NCBI)