Products 10445-04-2
CAS 10445-04-2 appears in our catalog under these names: 5-(4-(Trifluoromethyl)phenyl)-1，3，4-thiadiazol-2-amine, 97%, 97%, 5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine (CAS 10445-04-2) is a chemical compound with the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. IUPAC name: 5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine. InChIKey: IKOYAQXGLSFYSH-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 5-[4-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | IKOYAQXGLSFYSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(S2)N)C(F)(F)F |
Computed by PubChem (NCBI)