Products 1153977-59-3
CAS 1153977-59-3 is the registry number for 3-(3-(Trifluoromethyl)phenyl)-1,2,4-thiadiazol-5-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-amine (CAS 1153977-59-3) is a chemical compound with the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-amine. InChIKey: XZTKEOPQVLVNRX-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-amine |
| InChIKey | XZTKEOPQVLVNRX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NSC(=N2)N |
Computed by PubChem (NCBI)