Products 1052694-84-4
CAS 1052694-84-4 appears in our catalog under these names: 2-Amino-5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazole, 95%, 5-(2-(Trifluoromethyl)benzyl)-1,3,4-thiadiazol-2-amine, 98%, 5-(2-(Trifluoromethyl)phenyl)-1,3,4-thiadiazol-2-amine, 98%, 98%, 2-Amino-5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazole, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine (CAS 1052694-84-4) is a chemical compound with the molecular formula C9H6F3N3S and a molecular weight of 245.23 g/mol. IUPAC name: 5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine. InChIKey: TWXQRAMCZAUPAN-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3S |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 5-[2-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | TWXQRAMCZAUPAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN=C(S2)N)C(F)(F)F |
Computed by PubChem (NCBI)