CAS 1044771-90-5 appears in our catalog under these names: 7-Bromo-1-ethyl-2-methyl-1H-imidazo(4,5-c)pyridine, 95%, 7-Bromo-1-ethyl-2-methyl-1H-imidazo(4,5-c)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-bromo-1-ethyl-2-methylimidazo[4,5-c]pyridine (CAS 1044771-90-5) is a chemical compound with the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. IUPAC name: 7-bromo-1-ethyl-2-methylimidazo[4,5-c]pyridine. InChIKey: LHYFNIBHNQBMRJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3 |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 7-bromo-1-ethyl-2-methylimidazo[4,5-c]pyridine |
| InChIKey | LHYFNIBHNQBMRJ-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=CN=CC(=C21)Br)C |
Computed by PubChem (NCBI)