CAS 1820704-52-6 is the registry number for 5-Bromo-1,7-dimethylindazol-3-amine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-1,7-dimethylindazol-3-amine (CAS 1820704-52-6) is a chemical compound with the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. IUPAC name: 5-bromo-1,7-dimethylindazol-3-amine. InChIKey: PKSJBVLMXDSHOQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3 |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 5-bromo-1,7-dimethylindazol-3-amine |
| InChIKey | PKSJBVLMXDSHOQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N(N=C2N)C)Br |
Computed by PubChem (NCBI)