Products 1380331-40-7
CAS 1380331-40-7 appears in our catalog under these names: 7-Bromo-2-isopropyl-[1,2,4]triazolo[1,5-a]pyridine, 95%, 7-Bromo-2-isopropyl-(1,2,4)triazolo(1,5-a)pyridine, 97%, 7-Bromo-2-isopropyl-[1,2,4]triazolo[1,5-a]pyridine, 97%, 97%, 7-BROMO-2-ISOPROPYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg, 500mg, 5g, 25g.
7-bromo-2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine (CAS 1380331-40-7) is a chemical compound with the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. IUPAC name: 7-bromo-2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: MHAZTFDFZAAHDW-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3 |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 7-bromo-2-propan-2-yl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | MHAZTFDFZAAHDW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN2C=CC(=CC2=N1)Br |
Computed by PubChem (NCBI)