CAS 212268-15-0 appears in our catalog under these names: 6-Bromo-2,3-dimethyl-imidazo[1,2-a]pyridin-8-ylamine, 95%, 6-Bromo-2,3-dimethylimidazo(1,2-a)pyridin-8-ylamine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-bromo-2,3-dimethylimidazo[1,2-a]pyridin-8-amine (CAS 212268-15-0) is a chemical compound with the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. IUPAC name: 6-bromo-2,3-dimethylimidazo[1,2-a]pyridin-8-amine. InChIKey: JNXOWVWCTOFBPU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3 |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 6-bromo-2,3-dimethylimidazo[1,2-a]pyridin-8-amine |
| InChIKey | JNXOWVWCTOFBPU-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(C=C(C2=N1)N)Br)C |
Computed by PubChem (NCBI)