CAS 6463-44-1 is the registry number for 1-(4-Bromophenyl)-4,5-dihydro-1H-pyrazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-3,4-dihydropyrazol-5-amine (CAS 6463-44-1) is a chemical compound with the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. IUPAC name: 2-(4-bromophenyl)-3,4-dihydropyrazol-5-amine. InChIKey: LZXKXJKLKIEWRU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3 |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 2-(4-bromophenyl)-3,4-dihydropyrazol-5-amine |
| InChIKey | LZXKXJKLKIEWRU-UHFFFAOYSA-N |
| SMILES | C1CN(N=C1N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)