Products 104515-21-1
CAS 104515-21-1 appears in our catalog under these names: 4,6-Dichloro-2-methylthieno[2,3-b]pyridine, 95%, 95%, 4,6-Dichloro-2-methylthieno[2,3-b]pyridine, 98%, 4,6-Dichloro-2-methylthieno[2,3-b]pyridine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,6-dichloro-2-methylthieno[2,3-b]pyridine (CAS 104515-21-1) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 4,6-dichloro-2-methylthieno[2,3-b]pyridine. InChIKey: VAZPQNCVJQNJNY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 4,6-dichloro-2-methylthieno[2,3-b]pyridine |
| InChIKey | VAZPQNCVJQNJNY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)