Products 1046317-40-1

CAS 1046317-40-1 is the registry number for 4-[2-(4-Bromophenyl)-2-carboxy-ethyl]-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

2-(4-bromophenyl)-3-(4-methoxycarbonylphenyl)propanoic acid (CAS 1046317-40-1) is a chemical compound with the molecular formula C17H15BrO4 and a molecular weight of 363.2 g/mol. IUPAC name: 2-(4-bromophenyl)-3-(4-methoxycarbonylphenyl)propanoic acid. InChIKey: VKUISRZHHRRZNX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15BrO4
Molecular weight363.2 g/mol
IUPAC name2-(4-bromophenyl)-3-(4-methoxycarbonylphenyl)propanoic acid
InChIKeyVKUISRZHHRRZNX-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)CC(C2=CC=C(C=C2)Br)C(=O)O

Computed by PubChem (NCBI)