CAS 512810-11-6 is the registry number for 3-{3-((4-Bromophenoxy)methyl)-4-methoxyphenyl}prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoic acid (CAS 512810-11-6) is a chemical compound with the molecular formula C17H15BrO4 and a molecular weight of 363.2 g/mol. IUPAC name: (E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoic acid. InChIKey: WBZITOJZVUHBAP-YCRREMRBSA-N.
| Molecular formula | C17H15BrO4 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | (E)-3-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]prop-2-enoic acid |
| InChIKey | WBZITOJZVUHBAP-YCRREMRBSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)O)COC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)