Products 1186048-29-2
CAS 1186048-29-2 appears in our catalog under these names: Dimethyl 2-(bromomethyl)-[1,1'-biphenyl]-4,4'-dicarboxylate, 97%, Dimethyl 2-(bromomethyl)-[1,1'-biphenyl]-4,4'-dicarboxylate, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-(bromomethyl)-4-(4-methoxycarbonylphenyl)benzoate (CAS 1186048-29-2) is a chemical compound with the molecular formula C17H15BrO4 and a molecular weight of 363.2 g/mol. IUPAC name: methyl 3-(bromomethyl)-4-(4-methoxycarbonylphenyl)benzoate. InChIKey: DZOVXWQFLLBJPL-UHFFFAOYSA-N.
| Molecular formula | C17H15BrO4 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | methyl 3-(bromomethyl)-4-(4-methoxycarbonylphenyl)benzoate |
| InChIKey | DZOVXWQFLLBJPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=C(C=C(C=C2)C(=O)OC)CBr |
Computed by PubChem (NCBI)