Products 1572464-22-2
CAS 1572464-22-2 is the registry number for F-17. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-bromophenyl)ethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 1572464-22-2) is a chemical compound with the molecular formula C17H15BrO4 and a molecular weight of 363.2 g/mol. IUPAC name: 2-(4-bromophenyl)ethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: LZYCAZXTUVKHNO-XBXARRHUSA-N.
| Molecular formula | C17H15BrO4 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | 2-(4-bromophenyl)ethyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | LZYCAZXTUVKHNO-XBXARRHUSA-N |
| SMILES | C1=CC(=CC=C1CCOC(=O)/C=C/C2=CC(=C(C=C2)O)O)Br |
Computed by PubChem (NCBI)