CAS 27475-14-5 appears in our catalog under these names: 5-Bromoacetyl-2-bensyloxbenzoic acid methyl ester, Salmeterol Impurity 16, Salbutamol Impurity 74, Methyl 2-(benzyloxy)-5-(2-bromoacetyl)benzoate 95%, Methyl 2-(benzyloxy)-5-(2-bromoacetyl)benzoate, 95%, 95%. Offered by: Biosynth, Chemat Brand, Ambeed, Chemat. Available pack sizes: 0,5g, on request, 100mg, 250mg, 1g, 5g.
Methyl 5-(2-bromoacetyl)-2-phenylmethoxybenzoate (CAS 27475-14-5) is a chemical compound with the molecular formula C17H15BrO4 and a molecular weight of 363.2 g/mol. IUPAC name: methyl 5-(2-bromoacetyl)-2-phenylmethoxybenzoate. InChIKey: AKWQRVIQUREMOK-UHFFFAOYSA-N.
| Molecular formula | C17H15BrO4 |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | methyl 5-(2-bromoacetyl)-2-phenylmethoxybenzoate |
| InChIKey | AKWQRVIQUREMOK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C(=O)CBr)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)