Products 1046534-67-1

CAS 1046534-67-1 is the registry number for (1,1-Dioxidotetrahydrothiophen-3-yl)-L-proline hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1046534-67-1) is a chemical compound with the molecular formula C9H16ClNO4S and a molecular weight of 269.75 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: USNGHAFAJFZRNK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16ClNO4S
Molecular weight269.75 g/mol
IUPAC name1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyUSNGHAFAJFZRNK-UHFFFAOYSA-N
SMILESC1CC(N(C1)C2CCS(=O)(=O)C2)C(=O)O.Cl

Computed by PubChem (NCBI)