CAS 1046534-67-1 is the registry number for (1,1-Dioxidotetrahydrothiophen-3-yl)-L-proline hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1046534-67-1) is a chemical compound with the molecular formula C9H16ClNO4S and a molecular weight of 269.75 g/mol. IUPAC name: 1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: USNGHAFAJFZRNK-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 1-(1,1-dioxothiolan-3-yl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | USNGHAFAJFZRNK-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C2CCS(=O)(=O)C2)C(=O)O.Cl |
Computed by PubChem (NCBI)