CAS 2270907-10-1 is the registry number for 1-(Cyclopropylsulfonyl)piperidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-cyclopropylsulfonylpiperidine-3-carboxylic acid;hydrochloride (CAS 2270907-10-1) is a chemical compound with the molecular formula C9H16ClNO4S and a molecular weight of 269.75 g/mol. IUPAC name: 1-cyclopropylsulfonylpiperidine-3-carboxylic acid;hydrochloride. InChIKey: BQDAUYQXWZFNIZ-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 1-cyclopropylsulfonylpiperidine-3-carboxylic acid;hydrochloride |
| InChIKey | BQDAUYQXWZFNIZ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)