CAS 1932525-90-0 is the registry number for (3R)-3-(Chlorosulfonyl)-1,1-dimethylethyl Ester 1-Pyrrolidinecarboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
Tert-butyl (3R)-3-chlorosulfonylpyrrolidine-1-carboxylate (CAS 1932525-90-0) is a chemical compound with the molecular formula C9H16ClNO4S and a molecular weight of 269.75 g/mol. IUPAC name: tert-butyl (3R)-3-chlorosulfonylpyrrolidine-1-carboxylate. InChIKey: NTBNFZSSXSSJBA-SSDOTTSWSA-N.
| Molecular formula | C9H16ClNO4S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | tert-butyl (3R)-3-chlorosulfonylpyrrolidine-1-carboxylate |
| InChIKey | NTBNFZSSXSSJBA-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)