CAS 2287260-36-8 is the registry number for 8,8-Dioxo-8λ6-thia-2-azaspiro(4.5)decane-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decane-3-carboxylic acid;hydrochloride (CAS 2287260-36-8) is a chemical compound with the molecular formula C9H16ClNO4S and a molecular weight of 269.75 g/mol. IUPAC name: 8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decane-3-carboxylic acid;hydrochloride. InChIKey: RLWGZDRXIZMJMV-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 8,8-dioxo-8lambda6-thia-2-azaspiro[4.5]decane-3-carboxylic acid;hydrochloride |
| InChIKey | RLWGZDRXIZMJMV-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12CC(NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)