CAS 2137662-12-3 is the registry number for 8-Amino-5-thiaspiro(3.5)nonane-2-carboxylic acid 5,5-dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonane-2-carboxylic acid;hydrochloride (CAS 2137662-12-3) is a chemical compound with the molecular formula C9H16ClNO4S and a molecular weight of 269.75 g/mol. IUPAC name: 8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonane-2-carboxylic acid;hydrochloride. InChIKey: JTERAVUOHBAIPL-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO4S |
|---|---|
| Molecular weight | 269.75 g/mol |
| IUPAC name | 8-amino-5,5-dioxo-5lambda6-thiaspiro[3.5]nonane-2-carboxylic acid;hydrochloride |
| InChIKey | JTERAVUOHBAIPL-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2(CC1N)CC(C2)C(=O)O.Cl |
Computed by PubChem (NCBI)