CAS 1046580-57-7 is the registry number for 4,7-Dichloro-2-ethylquinazoline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4,7-dichloro-2-ethylquinazoline (CAS 1046580-57-7) is a chemical compound with the molecular formula C10H8Cl2N2 and a molecular weight of 227.09 g/mol. IUPAC name: 4,7-dichloro-2-ethylquinazoline. InChIKey: QATWYASUAOBYHA-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2N2 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 4,7-dichloro-2-ethylquinazoline |
| InChIKey | QATWYASUAOBYHA-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C=CC(=C2)Cl)C(=N1)Cl |
Computed by PubChem (NCBI)