Products 1498300-48-3
CAS 1498300-48-3 appears in our catalog under these names: 3-Bromo-2-methyl-6-nitrobenzoic acid, 95%, 3-Bromo-2-methyl-6-nitrobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-bromo-2-methyl-6-nitrobenzoic acid (CAS 1498300-48-3) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 3-bromo-2-methyl-6-nitrobenzoic acid. InChIKey: SGZSISYCYAUVOZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 3-bromo-2-methyl-6-nitrobenzoic acid |
| InChIKey | SGZSISYCYAUVOZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)