CAS 1046757-32-7 appears in our catalog under these names: 2-Amino-n-(2-bromophenyl)acetamide hydrochloride, 95%, 2-amino-N-(2-bromophenyl)acetamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
2-amino-N-(2-bromophenyl)acetamide;hydrochloride (CAS 1046757-32-7) is a chemical compound with the molecular formula C8H10BrClN2O and a molecular weight of 265.53 g/mol. IUPAC name: 2-amino-N-(2-bromophenyl)acetamide;hydrochloride. InChIKey: NPEURHXBRMMWPU-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2O |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 2-amino-N-(2-bromophenyl)acetamide;hydrochloride |
| InChIKey | NPEURHXBRMMWPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CN)Br.Cl |
Computed by PubChem (NCBI)