Products 2138549-03-6
CAS 2138549-03-6 is the registry number for 3-Bromo-5,6,7,8-tetrahydro-1,6-naphthyridin-4-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-bromo-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-4-one;hydrochloride (CAS 2138549-03-6) is a chemical compound with the molecular formula C8H10BrClN2O and a molecular weight of 265.53 g/mol. IUPAC name: 3-bromo-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-4-one;hydrochloride. InChIKey: NBDSZPYAIOJOTC-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2O |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 3-bromo-5,6,7,8-tetrahydro-1H-1,6-naphthyridin-4-one;hydrochloride |
| InChIKey | NBDSZPYAIOJOTC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC=C(C2=O)Br.Cl |
Computed by PubChem (NCBI)