CAS 67386-39-4 is the registry number for 2-(4-Bromophenoxy)ethanimidamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
2-(4-bromophenoxy)ethanimidamide;hydrochloride (CAS 67386-39-4) is a chemical compound with the molecular formula C8H10BrClN2O and a molecular weight of 265.53 g/mol. IUPAC name: 2-(4-bromophenoxy)ethanimidamide;hydrochloride. InChIKey: QMCGBTTWYYBOGE-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2O |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 2-(4-bromophenoxy)ethanimidamide;hydrochloride |
| InChIKey | QMCGBTTWYYBOGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(=N)N)Br.Cl |
Computed by PubChem (NCBI)