Products 1181458-36-5

CAS 1181458-36-5 is the registry number for 2-Amino-n-(4-bromophenyl)acetamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-amino-N-(4-bromophenyl)acetamide;hydrochloride (CAS 1181458-36-5) is a chemical compound with the molecular formula C8H10BrClN2O and a molecular weight of 265.53 g/mol. IUPAC name: 2-amino-N-(4-bromophenyl)acetamide;hydrochloride. InChIKey: RSRMNANEVNSSPD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BrClN2O
Molecular weight265.53 g/mol
IUPAC name2-amino-N-(4-bromophenyl)acetamide;hydrochloride
InChIKeyRSRMNANEVNSSPD-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1NC(=O)CN)Br.Cl

Computed by PubChem (NCBI)