Products 1454907-51-7
CAS 1454907-51-7 is the registry number for 3-(5-Bromopyridin-2-yl)oxetan-3-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
3-(5-bromo-2-pyridinyl)oxetan-3-amine;hydrochloride (CAS 1454907-51-7) is a chemical compound with the molecular formula C8H10BrClN2O and a molecular weight of 265.53 g/mol. IUPAC name: 3-(5-bromo-2-pyridinyl)oxetan-3-amine;hydrochloride. InChIKey: DVGFVXGLCHUXMZ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrClN2O |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 3-(5-bromo-2-pyridinyl)oxetan-3-amine;hydrochloride |
| InChIKey | DVGFVXGLCHUXMZ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=NC=C(C=C2)Br)N.Cl |
Computed by PubChem (NCBI)