CAS 104839-08-9 appears in our catalog under these names: N-Boc-o-methyl-L-homoserine, Boc-HomoSer(Me)-OH 95%, N-[(1,1-Dimethylethoxy)carbonyl]-O-methyl-L-homoserine, 95%, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-4-methoxybutanoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
(2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 104839-08-9) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: (2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: ITXBKRHPHSTADP-ZETCQYMHSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2S)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | ITXBKRHPHSTADP-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCOC)C(=O)O |
Computed by PubChem (NCBI)