Products 1048664-09-0
CAS 1048664-09-0 appears in our catalog under these names: 2-(2-Chloro-6-methylphenoxy)ethanamine hydrochloride, 2-(2-Chloro-6-methylphenoxy)ethanamine hydrochloride, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 250mg, 5g.
2-(2-chloro-6-methylphenoxy)ethanamine;hydrochloride (CAS 1048664-09-0) is a chemical compound with the molecular formula C9H13Cl2NO and a molecular weight of 222.11 g/mol. IUPAC name: 2-(2-chloro-6-methylphenoxy)ethanamine;hydrochloride. InChIKey: UVDJEOZEWVHXDJ-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | 2-(2-chloro-6-methylphenoxy)ethanamine;hydrochloride |
| InChIKey | UVDJEOZEWVHXDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)OCCN.Cl |
Computed by PubChem (NCBI)