CAS 1048973-47-2 appears in our catalog under these names: (2Z)-2-(1-Hexyl-1,2-dihydro-2-oxo-3H-indol-3-ylidene) Hydrazide Benzoic Acid, MDA 19, MDA 19, 99.26%, MDA 19 (Standard). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 10mM (in 1ml dmso), 50mg, 50 mg, 5 mg, 10 mg.
N-(1-hexyl-2-hydroxyindol-3-yl)iminobenzamide (CAS 1048973-47-2) is a chemical compound with the molecular formula C21H23N3O2 and a molecular weight of 349.4 g/mol. IUPAC name: N-(1-hexyl-2-hydroxyindol-3-yl)iminobenzamide. InChIKey: ICNRTDOKKSWDRL-UHFFFAOYSA-N.
| Molecular formula | C21H23N3O2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-(1-hexyl-2-hydroxyindol-3-yl)iminobenzamide |
| InChIKey | ICNRTDOKKSWDRL-UHFFFAOYSA-N |
| SMILES | CCCCCCN1C2=CC=CC=C2C(=C1O)N=NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)