CAS 1222800-79-4 appears in our catalog under these names: ML324, ML324/ 97.49% (existing batch purity), ML324 98%, ML324, 98.35%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 10mg, 1mg, 5mg, 100mg, 10mM (in 1ml dmso), 50mg, 25mg, 250mg.
N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide (CAS 1222800-79-4) is a chemical compound with the molecular formula C21H23N3O2 and a molecular weight of 349.4 g/mol. IUPAC name: N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide. InChIKey: QDBVSOZTVKXUES-UHFFFAOYSA-N.
| Molecular formula | C21H23N3O2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-[3-(dimethylamino)propyl]-4-(8-hydroxyquinolin-6-yl)benzamide |
| InChIKey | QDBVSOZTVKXUES-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC(=O)C1=CC=C(C=C1)C2=CC(=C3C(=C2)C=CC=N3)O |
Computed by PubChem (NCBI)