CAS 285984-47-6 is the registry number for phenyl (3–(tert–butyl)–1–(p–tolyl)–1H–pyrazol–5–yl)carbaMate. Offered by: GLPBio. Available pack sizes: 200mg.
Phenyl N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate (CAS 285984-47-6) is a chemical compound with the molecular formula C21H23N3O2 and a molecular weight of 349.4 g/mol. IUPAC name: phenyl N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate. InChIKey: SILADEPIWJTLTA-UHFFFAOYSA-N.
| Molecular formula | C21H23N3O2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | phenyl N-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]carbamate |
| InChIKey | SILADEPIWJTLTA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=CC(=N2)C(C)(C)C)NC(=O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)