Products 1969264-37-6
CAS 1969264-37-6 appears in our catalog under these names: AB–BICA, N-((2S)-1-Amino-3-methyl-1-oxobutan-2-yl)-1-benzylindole-3-carboxamide. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-benzylindole-3-carboxamide (CAS 1969264-37-6) is a chemical compound with the molecular formula C21H23N3O2 and a molecular weight of 349.4 g/mol. IUPAC name: N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-benzylindole-3-carboxamide. InChIKey: KWZMKPNXFPNTEJ-IBGZPJMESA-N.
| Molecular formula | C21H23N3O2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-benzylindole-3-carboxamide |
| InChIKey | KWZMKPNXFPNTEJ-IBGZPJMESA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C1=CN(C2=CC=CC=C21)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)