CAS 1147893-81-9 appears in our catalog under these names: Latrepirdine Impurity 2, 5-(2-(2,8-Dimethyl-1,2,3,4-tetrahydro-5H-pyrido(4,3-b)indol-5-yl)ethyl)picolinic acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethyl]pyridine-2-carboxylic acid (CAS 1147893-81-9) is a chemical compound with the molecular formula C21H23N3O2 and a molecular weight of 349.4 g/mol. IUPAC name: 5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethyl]pyridine-2-carboxylic acid. InChIKey: QQMYEGPFXPDHCV-UHFFFAOYSA-N.
| Molecular formula | C21H23N3O2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 5-[2-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)ethyl]pyridine-2-carboxylic acid |
| InChIKey | QQMYEGPFXPDHCV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=C2CN(CC3)C)CCC4=CN=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)