Products 1072951-56-4
CAS 1072951-56-4 appears in our catalog under these names: (5-Bromo-2-(trifluoromethoxy)phenyl)boronic acid, 97%, 97%, (5-Bromo-2-(trifluoromethoxy)phenyl)boronic acid, 96%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
[5-bromo-2-(trifluoromethoxy)phenyl]boronic acid (CAS 1072951-56-4) is a chemical compound with the molecular formula C7H5BBrF3O3 and a molecular weight of 284.82 g/mol. IUPAC name: [5-bromo-2-(trifluoromethoxy)phenyl]boronic acid. InChIKey: GLPYFDWQKJBUGP-UHFFFAOYSA-N.
| Molecular formula | C7H5BBrF3O3 |
|---|---|
| Molecular weight | 284.82 g/mol |
| IUPAC name | [5-bromo-2-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | GLPYFDWQKJBUGP-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)