Products 2121514-59-6

CAS 2121514-59-6 is the registry number for 4-Bromo-3-(trifluoromethoxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

[4-bromo-3-(trifluoromethoxy)phenyl]boronic acid (CAS 2121514-59-6) is a chemical compound with the molecular formula C7H5BBrF3O3 and a molecular weight of 284.82 g/mol. IUPAC name: [4-bromo-3-(trifluoromethoxy)phenyl]boronic acid. InChIKey: HJBCGFUJDXXHOI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5BBrF3O3
Molecular weight284.82 g/mol
IUPAC name[4-bromo-3-(trifluoromethoxy)phenyl]boronic acid
InChIKeyHJBCGFUJDXXHOI-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)Br)OC(F)(F)F)(O)O

Computed by PubChem (NCBI)