CAS 1049130-93-9 is the registry number for 4'-Ethylbiphenyl-3-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(4-ethylphenyl)benzoic acid (CAS 1049130-93-9) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 3-(4-ethylphenyl)benzoic acid. InChIKey: CHQHBOMSKFIMJY-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-(4-ethylphenyl)benzoic acid |
| InChIKey | CHQHBOMSKFIMJY-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)