Products 104949-59-9
CAS 104949-59-9 is the registry number for 4-(2,2-Difluorocyclopropoxy)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(2,2-difluorocyclopropyl)oxyaniline (CAS 104949-59-9) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 4-(2,2-difluorocyclopropyl)oxyaniline. InChIKey: PKCTYIDSOQHYGB-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 4-(2,2-difluorocyclopropyl)oxyaniline |
| InChIKey | PKCTYIDSOQHYGB-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)