CAS 1227617-02-8 is the registry number for 3-(2,3-Difluorophenyl)azetidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,3-difluorophenyl)azetidin-3-ol (CAS 1227617-02-8) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 3-(2,3-difluorophenyl)azetidin-3-ol. InChIKey: RQNDOAYWHUWALP-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 3-(2,3-difluorophenyl)azetidin-3-ol |
| InChIKey | RQNDOAYWHUWALP-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=C(C(=CC=C2)F)F)O |
Computed by PubChem (NCBI)