CAS 1049606-32-7 is the registry number for 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1H-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole-4-carboxylic acid (CAS 1049606-32-7) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole-4-carboxylic acid. InChIKey: XZUIHMANNVXSEJ-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)triazole-4-carboxylic acid |
| InChIKey | XZUIHMANNVXSEJ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)N3C=C(N=N3)C(=O)O |
Computed by PubChem (NCBI)