Products 1049872-93-6
CAS 1049872-93-6 appears in our catalog under these names: 5-Methyl-n-(3-nitrophenyl)isoxazole-4-carboxamide, 95%, 5-Methyl-N-(3-nitrophenyl)-1,2-oxazole-4-carboxamide, 95%, 5-Methyl-N-(3-nitrophenyl)-1,2-oxazole-4-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-methyl-N-(3-nitrophenyl)-1,2-oxazole-4-carboxamide (CAS 1049872-93-6) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 5-methyl-N-(3-nitrophenyl)-1,2-oxazole-4-carboxamide. InChIKey: KXPAHNHHCVICGF-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 5-methyl-N-(3-nitrophenyl)-1,2-oxazole-4-carboxamide |
| InChIKey | KXPAHNHHCVICGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NO1)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)