Products 73953-89-6
CAS 73953-89-6 is the registry number for 1-Benzyl-1,2,3-triazole-4,5-dicarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-benzyltriazole-4,5-dicarboxylic acid (CAS 73953-89-6) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 1-benzyltriazole-4,5-dicarboxylic acid. InChIKey: IYYBUXUZYWGZGB-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 1-benzyltriazole-4,5-dicarboxylic acid |
| InChIKey | IYYBUXUZYWGZGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=C(N=N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-Benzyl-1,2,3-triazole-4,5-dicarboxylic acid, v-Triazole-4,5-dicarboxylic acid, 1-benzyl-, 1H-1,2,3-Triazole-4,5-dicarboxylic acid, 1-(phenylmethyl)-, 4-26-00-00965 (Beilstein Handbook Reference), 1-Benzyl-1,2,3-triazol-4,5-dicarboxylic acid, IYYBUXUZYWGZGB-UHFFFAOYSA-N, 1-Benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid, 1-benzyltriazole-4,5-dicarboxylic acid, Oprea1_261084, 1-benzyl1,2,3-triazole-4,5-dicarboxylic acid