Products 925145-56-8
CAS 925145-56-8 appears in our catalog under these names: 2-[(4-Nitro-1h-pyrazol-1-yl)methyl]benzoic acid, 95%, 2-((4-Nitro-1H-pyrazol-1-yl)methyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[(4-nitropyrazol-1-yl)methyl]benzoic acid (CAS 925145-56-8) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 2-[(4-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: VZAQMWCFGKUZAB-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 2-[(4-nitropyrazol-1-yl)methyl]benzoic acid |
| InChIKey | VZAQMWCFGKUZAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(C=N2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)