Products 879465-94-8

CAS 879465-94-8 is the registry number for 4-((3-Nitro-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-[(3-nitropyrazol-1-yl)methyl]benzoic acid (CAS 879465-94-8) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 4-[(3-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: DBMACUOANYJOMN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9N3O4
Molecular weight247.21 g/mol
IUPAC name4-[(3-nitropyrazol-1-yl)methyl]benzoic acid
InChIKeyDBMACUOANYJOMN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CN2C=CC(=N2)[N+](=O)[O-])C(=O)O

Computed by PubChem (NCBI)