CAS 879465-94-8 is the registry number for 4-((3-Nitro-1H-pyrazol-1-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-[(3-nitropyrazol-1-yl)methyl]benzoic acid (CAS 879465-94-8) is a chemical compound with the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. IUPAC name: 4-[(3-nitropyrazol-1-yl)methyl]benzoic acid. InChIKey: DBMACUOANYJOMN-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O4 |
|---|---|
| Molecular weight | 247.21 g/mol |
| IUPAC name | 4-[(3-nitropyrazol-1-yl)methyl]benzoic acid |
| InChIKey | DBMACUOANYJOMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=CC(=N2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)