CAS 1049727-83-4 is the registry number for (R)-2-(3,4-Dichlorobenzyl)pyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride (CAS 1049727-83-4) is a chemical compound with the molecular formula C12H14Cl3NO2 and a molecular weight of 310.6 g/mol. IUPAC name: (2R)-2-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: ZNAVYFGBDRNYAI-UTONKHPSSA-N.
| Molecular formula | C12H14Cl3NO2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | (2R)-2-[(3,4-dichlorophenyl)methyl]pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | ZNAVYFGBDRNYAI-UTONKHPSSA-N |
| SMILES | C1C[C@@](NC1)(CC2=CC(=C(C=C2)Cl)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)