CAS 938990-63-7 is the registry number for N-(tert-Butyl)-2-(2,4,5-trichlorophenoxy)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-tert-butyl-2-(2,4,5-trichlorophenoxy)acetamide (CAS 938990-63-7) is a chemical compound with the molecular formula C12H14Cl3NO2 and a molecular weight of 310.6 g/mol. IUPAC name: N-tert-butyl-2-(2,4,5-trichlorophenoxy)acetamide. InChIKey: RCHQZXPGYZVKOI-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl3NO2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | N-tert-butyl-2-(2,4,5-trichlorophenoxy)acetamide |
| InChIKey | RCHQZXPGYZVKOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)COC1=CC(=C(C=C1Cl)Cl)Cl |
Computed by PubChem (NCBI)