Products 1829917-53-4
CAS 1829917-53-4 is the registry number for 1-(3,4-Dichlorobenzyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3,4-dichlorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1829917-53-4) is a chemical compound with the molecular formula C12H14Cl3NO2 and a molecular weight of 310.6 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: AFYSZDXNWAWQGQ-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl3NO2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | AFYSZDXNWAWQGQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)CC2=CC(=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)